ChemNet > CAS > 98800-10-3 methyl thieno[3,2-b]thiophene-2-carboxylate
98800-10-3 methyl thieno[3,2-b]thiophene-2-carboxylate
| product Name |
methyl thieno[3,2-b]thiophene-2-carboxylate |
| CAS No |
98800-10-3 |
| Molecular Formula |
C8H6O2S2 |
| Molecular Weight |
198.262 |
| InChI |
InChI=1/C8H6O2S2/c1-10-8(9)7-4-6-5(12-7)2-3-11-6/h2-4H,1H3 |
| Molecular Structure |
![98800-10-3 methyl thieno[3,2-b]thiophene-2-carboxylate](https://images-a.chemnet.com/suppliers/chembase/cas11/cas98800-10-3.gif)
|
| Density |
1.412g/cm3 |
| Melting point |
94℃ |
| Boiling point |
306.1°C at 760 mmHg |
| Refractive index |
1.673 |
| Flash point |
138.9°C |
| Vapour Pressur |
0.000788mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
